C19H15FN2O4 — CID 110412198
2-[3-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)-3-oxopropyl]isoindole-1,3-dione (PubChem CID 110412198) has the molecular formula C19H15FN2O4 and a molecular weight of 354.34 g/mol. Its IUPAC name is 2-[3-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 110412198 |
| Molecular Formula | C19H15FN2O4 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-[3-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)-3-oxopropyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCC(=O)N1CCOc2ccc(F)cc21 |
| InChI | InChI=1S/C19H15FN2O4/c20-12-5-6-16-15(11-12)21(9-10-26-16)17(23)7-8-22-18(24)13-3-1-2-4-14(13)19(22)25/h1-6,11H,7-10H2 |
| InChIKey | CNHLBIGSATXJOR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|