About 6-fluoro-2,3-dihydro-1,4-benzoxazine-4-carboxylic acid
6-fluoro-2,3-dihydro-1,4-benzoxazine-4-carboxylic acid (PubChem CID 91461591) has the molecular formula C9H8FNO3
and a molecular weight of 197.17 g/mol. Its IUPAC name is 6-fluoro-2,3-dihydro-1,4-benzoxazine-4-carboxylic acid.
Analyze 6-fluoro-2,3-dihydro-1,4-benzoxazine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2,3-dihydro-1,4-benzoxazine-4-carboxylic acid?
The IUPAC name of 6-fluoro-2,3-dihydro-1,4-benzoxazine-4-carboxylic acid (CID 91461591) is 6-fluoro-2,3-dihydro-1,4-benzoxazine-4-carboxylic acid.
What is the SMILES notation for 6-fluoro-2,3-dihydro-1,4-benzoxazine-4-carboxylic acid?
The canonical SMILES for 6-fluoro-2,3-dihydro-1,4-benzoxazine-4-carboxylic acid is O=C(O)N1CCOc2ccc(F)cc21.
What is the InChIKey of 6-fluoro-2,3-dihydro-1,4-benzoxazine-4-carboxylic acid?
The InChIKey is FFGTYGFUBGDMEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO3/c10-6-1-2-8-7(5-6)11(9(12)13)3-4-14-8/h1-2,5H,3-4H2,(H,12,13).
What are the key properties of 6-fluoro-2,3-dihydro-1,4-benzoxazine-4-carboxylic acid?
6-fluoro-2,3-dihydro-1,4-benzoxazine-4-carboxylic acid has a molecular weight of 197.17 g/mol, XLogP of 1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2,3-dihydro-1,4-benzoxazine-4-carboxylic acid is sourced from PubChem (CID 91461591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).