C15H9F4NO2 — CID 110639332
(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)-(2,3,4-trifluorophenyl)methanone (PubChem CID 110639332) has the molecular formula C15H9F4NO2 and a molecular weight of 311.23 g/mol. Its IUPAC name is (6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)-(2,3,4-trifluorophenyl)methanone.
| Compound Name | (6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 110639332 |
| Molecular Formula | C15H9F4NO2 |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1F)N1CCOc2ccc(F)cc21 |
| InChI | InChI=1S/C15H9F4NO2/c16-8-1-4-12-11(7-8)20(5-6-22-12)15(21)9-2-3-10(17)14(19)13(9)18/h1-4,7H,5-6H2 |
| InChIKey | NVMWMFQNMYLHDN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|