C15H27NO — CID 143401269
4-methyl-2,3-dihydro-1,4-benzoxazine;propane (PubChem CID 143401269) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 4-methyl-2,3-dihydro-1,4-benzoxazine;propane.
| Compound Name | 4-methyl-2,3-dihydro-1,4-benzoxazine;propane |
|---|---|
| PubChem CID | 143401269 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 4-methyl-2,3-dihydro-1,4-benzoxazine;propane |
| SMILES | CCC.CCC.CN1CCOc2ccccc21 |
| InChI | InChI=1S/C9H11NO.2C3H8/c1-10-6-7-11-9-5-3-2-4-8(9)10;2*1-3-2/h2-5H,6-7H2,1H3;2*3H2,1-2H3 |
| InChIKey | SCYWQNPBDPSVEG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |