C9H11NOS — CID 146777459
4-methylsulfanyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 146777459) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is 4-methylsulfanyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-methylsulfanyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 146777459 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 4-methylsulfanyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CSN1CCOc2ccccc21 |
| InChI | InChI=1S/C9H11NOS/c1-12-10-6-7-11-9-5-3-2-4-8(9)10/h2-5H,6-7H2,1H3 |
| InChIKey | RSZRGHXHBGXHMB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|