C12H13NO2 — CID 112727331
1-(2,3-dihydro-1,4-benzoxazin-4-yl)but-2-en-1-one (PubChem CID 112727331) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzoxazin-4-yl)but-2-en-1-one.
| Compound Name | 1-(2,3-dihydro-1,4-benzoxazin-4-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 112727331 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzoxazin-4-yl)but-2-en-1-one |
| SMILES | CC=CC(=O)N1CCOc2ccccc21 |
| InChI | InChI=1S/C12H13NO2/c1-2-5-12(14)13-8-9-15-11-7-4-3-6-10(11)13/h2-7H,8-9H2,1H3 |
| InChIKey | DQZJKMFOERFJFP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|