C13H16BrNO2 — CID 59700557
5-bromo-1-(2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-one (PubChem CID 59700557) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is 5-bromo-1-(2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-one.
| Compound Name | 5-bromo-1-(2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-one |
|---|---|
| PubChem CID | 59700557 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 5-bromo-1-(2,3-dihydro-1,4-benzoxazin-4-yl)pentan-1-one |
| SMILES | O=C(CCCCBr)N1CCOc2ccccc21 |
| InChI | InChI=1S/C13H16BrNO2/c14-8-4-3-7-13(16)15-9-10-17-12-6-2-1-5-11(12)15/h1-2,5-6H,3-4,7-10H2 |
| InChIKey | IWXUFCQMOCVZLE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|