C26H26N2O3 — CID 56582322
N,N-dibenzyl-4-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide (PubChem CID 56582322) has the molecular formula C26H26N2O3 and a molecular weight of 414.50 g/mol. Its IUPAC name is N,N-dibenzyl-4-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide.
| Compound Name | N,N-dibenzyl-4-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 56582322 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N,N-dibenzyl-4-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)N1CCOc2ccccc21)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H26N2O3/c29-25(15-16-26(30)28-17-18-31-24-14-8-7-13-23(24)28)27(19-21-9-3-1-4-10-21)20-22-11-5-2-6-12-22/h1-14H,15-20H2 |
| InChIKey | LBJUWKOAHBTNKG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |