C24H31N3O3 — CID 22513091
N-[3-[benzyl(ethyl)amino]propyl]-4-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide (PubChem CID 22513091) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-[3-[benzyl(ethyl)amino]propyl]-4-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide.
| Compound Name | N-[3-[benzyl(ethyl)amino]propyl]-4-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 22513091 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | N-[3-[benzyl(ethyl)amino]propyl]-4-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanamide |
| SMILES | CCN(CCCNC(=O)CCC(=O)N1CCOc2ccccc21)Cc1ccccc1 |
| InChI | InChI=1S/C24H31N3O3/c1-2-26(19-20-9-4-3-5-10-20)16-8-15-25-23(28)13-14-24(29)27-17-18-30-22-12-7-6-11-21(22)27/h3-7,9-12H,2,8,13-19H2,1H3,(H,25,28) |
| InChIKey | ZCWVVKDSRLPCTF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|