C26H26N2O3 — CID 56563124
4-(2,3-dihydro-1,4-benzoxazin-4-yl)-N-(1,2-diphenylethyl)-4-oxobutanamide (PubChem CID 56563124) has the molecular formula C26H26N2O3 and a molecular weight of 414.50 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzoxazin-4-yl)-N-(1,2-diphenylethyl)-4-oxobutanamide.
| Compound Name | 4-(2,3-dihydro-1,4-benzoxazin-4-yl)-N-(1,2-diphenylethyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 56563124 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzoxazin-4-yl)-N-(1,2-diphenylethyl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)N1CCOc2ccccc21)NC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O3/c29-25(15-16-26(30)28-17-18-31-24-14-8-7-13-23(24)28)27-22(21-11-5-2-6-12-21)19-20-9-3-1-4-10-20/h1-14,22H,15-19H2,(H,27,29) |
| InChIKey | YUZLPJNIJMUUGE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |