About 4-propyl-3,5-dihydro-2H-1,4-benzoxazepine
4-propyl-3,5-dihydro-2H-1,4-benzoxazepine (PubChem CID 121184859) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-propyl-3,5-dihydro-2H-1,4-benzoxazepine.
Molecular Properties
| Compound Name | 4-propyl-3,5-dihydro-2H-1,4-benzoxazepine |
| PubChem CID | 121184859 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-propyl-3,5-dihydro-2H-1,4-benzoxazepine |
| SMILES | CCCN1CCOc2ccccc2C1 |
| InChI | InChI=1S/C12H17NO/c1-2-7-13-8-9-14-12-6-4-3-5-11(12)10-13/h3-6H,2,7-10H2,1H3 |
| InChIKey | BEELFCALNIXXBF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propyl-3,5-dihydro-2H-1,4-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propyl-3,5-dihydro-2H-1,4-benzoxazepine?
The IUPAC name of 4-propyl-3,5-dihydro-2H-1,4-benzoxazepine (CID 121184859) is 4-propyl-3,5-dihydro-2H-1,4-benzoxazepine.
What is the SMILES notation for 4-propyl-3,5-dihydro-2H-1,4-benzoxazepine?
The canonical SMILES for 4-propyl-3,5-dihydro-2H-1,4-benzoxazepine is CCCN1CCOc2ccccc2C1.
What is the InChIKey of 4-propyl-3,5-dihydro-2H-1,4-benzoxazepine?
The InChIKey is BEELFCALNIXXBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-2-7-13-8-9-14-12-6-4-3-5-11(12)10-13/h3-6H,2,7-10H2,1H3.
What are the key properties of 4-propyl-3,5-dihydro-2H-1,4-benzoxazepine?
4-propyl-3,5-dihydro-2H-1,4-benzoxazepine has a molecular weight of 191.27 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propyl-3,5-dihydro-2H-1,4-benzoxazepine is sourced from PubChem (CID 121184859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).