C14H21NO2 — CID 55160022
5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pentan-2-ol (PubChem CID 55160022) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pentan-2-ol.
| Compound Name | 5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pentan-2-ol |
|---|---|
| PubChem CID | 55160022 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pentan-2-ol |
| SMILES | CC(O)CCCN1CCOc2ccccc2C1 |
| InChI | InChI=1S/C14H21NO2/c1-12(16)5-4-8-15-9-10-17-14-7-3-2-6-13(14)11-15/h2-3,6-7,12,16H,4-5,8-11H2,1H3 |
| InChIKey | ALIAYHJOEIGMFO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |