C10H11NO2 — CID 83668267
5-methyl-4H-1,5-benzoxazepin-3-one (PubChem CID 83668267) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 5-methyl-4H-1,5-benzoxazepin-3-one.
| Compound Name | 5-methyl-4H-1,5-benzoxazepin-3-one |
|---|---|
| PubChem CID | 83668267 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 5-methyl-4H-1,5-benzoxazepin-3-one |
| SMILES | CN1CC(=O)COc2ccccc21 |
| InChI | InChI=1S/C10H11NO2/c1-11-6-8(12)7-13-10-5-3-2-4-9(10)11/h2-5H,6-7H2,1H3 |
| InChIKey | SKFAAHSTPKUZAJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |