C11H11NO3 — CID 18325679
4-propanoyl-1,4-benzoxazin-3-one (PubChem CID 18325679) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 4-propanoyl-1,4-benzoxazin-3-one.
| Compound Name | 4-propanoyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 18325679 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 4-propanoyl-1,4-benzoxazin-3-one |
| SMILES | CCC(=O)N1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C11H11NO3/c1-2-10(13)12-8-5-3-4-6-9(8)15-7-11(12)14/h3-6H,2,7H2,1H3 |
| InChIKey | OEAAMEMUMQJXEC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |