C10H10N2O4 — CID 115139606
6-amino-4-(2-hydroxyacetyl)-1,4-benzoxazin-3-one (PubChem CID 115139606) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 6-amino-4-(2-hydroxyacetyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-amino-4-(2-hydroxyacetyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115139606 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 6-amino-4-(2-hydroxyacetyl)-1,4-benzoxazin-3-one |
| SMILES | Nc1ccc2c(c1)N(C(=O)CO)C(=O)CO2 |
| InChI | InChI=1S/C10H10N2O4/c11-6-1-2-8-7(3-6)12(9(14)4-13)10(15)5-16-8/h1-3,13H,4-5,11H2 |
| InChIKey | LPUDFJMFDXTCGR-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|