C11H13N3O4 — CID 115179616
6-amino-4-(2-amino-3-hydroxypropanoyl)-1,4-benzoxazin-3-one (PubChem CID 115179616) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 6-amino-4-(2-amino-3-hydroxypropanoyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-amino-4-(2-amino-3-hydroxypropanoyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115179616 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 6-amino-4-(2-amino-3-hydroxypropanoyl)-1,4-benzoxazin-3-one |
| SMILES | Nc1ccc2c(c1)N(C(=O)C(N)CO)C(=O)CO2 |
| InChI | InChI=1S/C11H13N3O4/c12-6-1-2-9-8(3-6)14(10(16)5-18-9)11(17)7(13)4-15/h1-3,7,15H,4-5,12-13H2 |
| InChIKey | JJGNFDYPLUPVCW-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 118.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|