C12H15N3O4 — CID 115241032
2-amino-4-(6-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid (PubChem CID 115241032) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-amino-4-(6-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid.
| Compound Name | 2-amino-4-(6-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid |
|---|---|
| PubChem CID | 115241032 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-amino-4-(6-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid |
| SMILES | Nc1ccc2c(c1)N(CCC(N)C(=O)O)C(=O)CO2 |
| InChI | InChI=1S/C12H15N3O4/c13-7-1-2-10-9(5-7)15(11(16)6-19-10)4-3-8(14)12(17)18/h1-2,5,8H,3-4,6,13-14H2,(H,17,18) |
| InChIKey | QGUDBEKFGBZHTN-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 118.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|