C22H22N4O6 — CID 40963421
(2S)-2-(3-oxo-1,4-benzoxazin-4-yl)-N'-[(2S)-2-(3-oxo-1,4-benzoxazin-4-yl)propanoyl]propanehydrazide (PubChem CID 40963421) has the molecular formula C22H22N4O6 and a molecular weight of 438.44 g/mol. Its IUPAC name is (2S)-2-(3-oxo-1,4-benzoxazin-4-yl)-N'-[(2S)-2-(3-oxo-1,4-benzoxazin-4-yl)propanoyl]propanehydrazide.
| Compound Name | (2S)-2-(3-oxo-1,4-benzoxazin-4-yl)-N'-[(2S)-2-(3-oxo-1,4-benzoxazin-4-yl)propanoyl]propanehydrazide |
|---|---|
| PubChem CID | 40963421 |
| Molecular Formula | C22H22N4O6 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (2S)-2-(3-oxo-1,4-benzoxazin-4-yl)-N'-[(2S)-2-(3-oxo-1,4-benzoxazin-4-yl)propanoyl]propanehydrazide |
| SMILES | C[C@@H](C(=O)NNC(=O)[C@H](C)N1C(=O)COc2ccccc21)N1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C22H22N4O6/c1-13(25-15-7-3-5-9-17(15)31-11-19(25)27)21(29)23-24-22(30)14(2)26-16-8-4-6-10-18(16)32-12-20(26)28/h3-10,13-14H,11-12H2,1-2H3,(H,23,29)(H,24,30)/t13-,14-/m0/s1 |
| InChIKey | FIAYUQONLWAMTC-KBPBESRZSA-N |
| XLogP | 0.76 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|