C10H8FNO4 — CID 81297577
2-fluoro-2-(3-oxo-1,4-benzoxazin-4-yl)acetic acid (PubChem CID 81297577) has the molecular formula C10H8FNO4 and a molecular weight of 225.18 g/mol. Its IUPAC name is 2-fluoro-2-(3-oxo-1,4-benzoxazin-4-yl)acetic acid.
| Compound Name | 2-fluoro-2-(3-oxo-1,4-benzoxazin-4-yl)acetic acid |
|---|---|
| PubChem CID | 81297577 |
| Molecular Formula | C10H8FNO4 |
| Molecular Weight | 225.18 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2-fluoro-2-(3-oxo-1,4-benzoxazin-4-yl)acetic acid |
| SMILES | O=C(O)C(F)N1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C10H8FNO4/c11-9(10(14)15)12-6-3-1-2-4-7(6)16-5-8(12)13/h1-4,9H,5H2,(H,14,15) |
| InChIKey | YNBZEYRMQTZSOH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|