C15H18N2O5 — CID 119136995
3-methyl-2-[[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]butanoic acid (PubChem CID 119136995) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 3-methyl-2-[[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119136995 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-methyl-2-[[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]butanoic acid |
| SMILES | CC(C)C(NC(=O)CN1C(=O)COc2ccccc21)C(=O)O |
| InChI | InChI=1S/C15H18N2O5/c1-9(2)14(15(20)21)16-12(18)7-17-10-5-3-4-6-11(10)22-8-13(17)19/h3-6,9,14H,7-8H2,1-2H3,(H,16,18)(H,20,21) |
| InChIKey | YSMZMCQRUICNBN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |