C21H22ClN3O4 — CID 9225833
(2R)-2-(4-chlorophenyl)-3-methyl-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]butanehydrazide (PubChem CID 9225833) has the molecular formula C21H22ClN3O4 and a molecular weight of 415.88 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)-3-methyl-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]butanehydrazide.
| Compound Name | (2R)-2-(4-chlorophenyl)-3-methyl-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]butanehydrazide |
|---|---|
| PubChem CID | 9225833 |
| Molecular Formula | C21H22ClN3O4 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)-3-methyl-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]butanehydrazide |
| SMILES | CC(C)[C@@H](C(=O)NNC(=O)CN1C(=O)COc2ccccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClN3O4/c1-13(2)20(14-7-9-15(22)10-8-14)21(28)24-23-18(26)11-25-16-5-3-4-6-17(16)29-12-19(25)27/h3-10,13,20H,11-12H2,1-2H3,(H,23,26)(H,24,28)/t20-/m1/s1 |
| InChIKey | PEFXSTNLROJAPV-HXUWFJFHSA-N |
| XLogP | 2.65 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|