C17H17N3O5 — CID 17431901
3-(furan-2-yl)-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]propanehydrazide (PubChem CID 17431901) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is 3-(furan-2-yl)-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]propanehydrazide.
| Compound Name | 3-(furan-2-yl)-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 17431901 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 3-(furan-2-yl)-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]propanehydrazide |
| SMILES | O=C(CCc1ccco1)NNC(=O)CN1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C17H17N3O5/c21-15(8-7-12-4-3-9-24-12)18-19-16(22)10-20-13-5-1-2-6-14(13)25-11-17(20)23/h1-6,9H,7-8,10-11H2,(H,18,21)(H,19,22) |
| InChIKey | CMBIMITVKRRNAI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|