C18H22N4O6 — CID 9237466
4-morpholin-4-yl-4-oxo-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]butanehydrazide (PubChem CID 9237466) has the molecular formula C18H22N4O6 and a molecular weight of 390.40 g/mol. Its IUPAC name is 4-morpholin-4-yl-4-oxo-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]butanehydrazide.
| Compound Name | 4-morpholin-4-yl-4-oxo-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]butanehydrazide |
|---|---|
| PubChem CID | 9237466 |
| Molecular Formula | C18H22N4O6 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 4-morpholin-4-yl-4-oxo-N'-[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]butanehydrazide |
| SMILES | O=C(CCC(=O)N1CCOCC1)NNC(=O)CN1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C18H22N4O6/c23-15(5-6-17(25)21-7-9-27-10-8-21)19-20-16(24)11-22-13-3-1-2-4-14(13)28-12-18(22)26/h1-4H,5-12H2,(H,19,23)(H,20,24) |
| InChIKey | BXBDDEBKUJWFMK-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|