C17H16N2O4 — CID 51072486
2-(3-oxo-1,4-benzoxazin-4-yl)-N-phenylmethoxyacetamide (PubChem CID 51072486) has the molecular formula C17H16N2O4 and a molecular weight of 312.32 g/mol. Its IUPAC name is 2-(3-oxo-1,4-benzoxazin-4-yl)-N-phenylmethoxyacetamide.
| Compound Name | 2-(3-oxo-1,4-benzoxazin-4-yl)-N-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 51072486 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-(3-oxo-1,4-benzoxazin-4-yl)-N-phenylmethoxyacetamide |
| SMILES | O=C(CN1C(=O)COc2ccccc21)NOCc1ccccc1 |
| InChI | InChI=1S/C17H16N2O4/c20-16(18-23-11-13-6-2-1-3-7-13)10-19-14-8-4-5-9-15(14)22-12-17(19)21/h1-9H,10-12H2,(H,18,20) |
| InChIKey | VZKZLKZGMRNZEF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|