C20H21N3O5S — CID 9429427
N'-[2-(4-ethoxyphenyl)sulfanylacetyl]-2-(3-oxo-1,4-benzoxazin-4-yl)acetohydrazide (PubChem CID 9429427) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is N'-[2-(4-ethoxyphenyl)sulfanylacetyl]-2-(3-oxo-1,4-benzoxazin-4-yl)acetohydrazide.
| Compound Name | N'-[2-(4-ethoxyphenyl)sulfanylacetyl]-2-(3-oxo-1,4-benzoxazin-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 9429427 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N'-[2-(4-ethoxyphenyl)sulfanylacetyl]-2-(3-oxo-1,4-benzoxazin-4-yl)acetohydrazide |
| SMILES | CCOc1ccc(SCC(=O)NNC(=O)CN2C(=O)COc3ccccc32)cc1 |
| InChI | InChI=1S/C20H21N3O5S/c1-2-27-14-7-9-15(10-8-14)29-13-19(25)22-21-18(24)11-23-16-5-3-4-6-17(16)28-12-20(23)26/h3-10H,2,11-13H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | GEVXHUQMSSMHTC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|