About 4-(3-morpholin-4-ylphenyl)-2,3-dihydro-1,4-benzoxazine
4-(3-morpholin-4-ylphenyl)-2,3-dihydro-1,4-benzoxazine (PubChem CID 174643080) has the molecular formula C18H20N2O2
and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-(3-morpholin-4-ylphenyl)-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 4-(3-morpholin-4-ylphenyl)-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 174643080 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 4-(3-morpholin-4-ylphenyl)-2,3-dihydro-1,4-benzoxazine |
| SMILES | c1cc(N2CCOCC2)cc(N2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C18H20N2O2/c1-2-7-18-17(6-1)20(10-13-22-18)16-5-3-4-15(14-16)19-8-11-21-12-9-19/h1-7,14H,8-13H2 |
| InChIKey | GDPXPKVUTHTZMP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-morpholin-4-ylphenyl)-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-morpholin-4-ylphenyl)-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 4-(3-morpholin-4-ylphenyl)-2,3-dihydro-1,4-benzoxazine (CID 174643080) is 4-(3-morpholin-4-ylphenyl)-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 4-(3-morpholin-4-ylphenyl)-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 4-(3-morpholin-4-ylphenyl)-2,3-dihydro-1,4-benzoxazine is c1cc(N2CCOCC2)cc(N2CCOc3ccccc32)c1.
What is the InChIKey of 4-(3-morpholin-4-ylphenyl)-2,3-dihydro-1,4-benzoxazine?
The InChIKey is GDPXPKVUTHTZMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O2/c1-2-7-18-17(6-1)20(10-13-22-18)16-5-3-4-15(14-16)19-8-11-21-12-9-19/h1-7,14H,8-13H2.
What are the key properties of 4-(3-morpholin-4-ylphenyl)-2,3-dihydro-1,4-benzoxazine?
4-(3-morpholin-4-ylphenyl)-2,3-dihydro-1,4-benzoxazine has a molecular weight of 296.37 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-morpholin-4-ylphenyl)-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 174643080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).