C14H12N2O3 — CID 59199731
4-(3-nitrophenyl)-2,3-dihydro-1,4-benzoxazine (PubChem CID 59199731) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-(3-nitrophenyl)-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 59199731 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-(3-nitrophenyl)-2,3-dihydro-1,4-benzoxazine |
| SMILES | O=[N+]([O-])c1cccc(N2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C14H12N2O3/c17-16(18)12-5-3-4-11(10-12)15-8-9-19-14-7-2-1-6-13(14)15/h1-7,10H,8-9H2 |
| InChIKey | SVAFIGGCHHHXIL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|