C15H17N3O — CID 106751101
4-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)benzene-1,2-diamine (PubChem CID 106751101) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)benzene-1,2-diamine.
| Compound Name | 4-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 106751101 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)benzene-1,2-diamine |
| SMILES | Nc1ccc(N2CCCOc3ccccc32)cc1N |
| InChI | InChI=1S/C15H17N3O/c16-12-7-6-11(10-13(12)17)18-8-3-9-19-15-5-2-1-4-14(15)18/h1-2,4-7,10H,3,8-9,16-17H2 |
| InChIKey | LYXNQJQWXXRTII-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|