C13H12IN3O — CID 116649056
5-(5-iodopyrimidin-2-yl)-3,4-dihydro-2H-1,5-benzoxazepine (PubChem CID 116649056) has the molecular formula C13H12IN3O and a molecular weight of 353.16 g/mol. Its IUPAC name is 5-(5-iodopyrimidin-2-yl)-3,4-dihydro-2H-1,5-benzoxazepine.
| Compound Name | 5-(5-iodopyrimidin-2-yl)-3,4-dihydro-2H-1,5-benzoxazepine |
|---|---|
| PubChem CID | 116649056 |
| Molecular Formula | C13H12IN3O |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 5-(5-iodopyrimidin-2-yl)-3,4-dihydro-2H-1,5-benzoxazepine |
| SMILES | Ic1cnc(N2CCCOc3ccccc32)nc1 |
| InChI | InChI=1S/C13H12IN3O/c14-10-8-15-13(16-9-10)17-6-3-7-18-12-5-2-1-4-11(12)17/h1-2,4-5,8-9H,3,6-7H2 |
| InChIKey | RSXSVXHRMOUYSV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|