C19H22N2O4 — CID 122587503
3-[3-amino-4-(2,3-dihydro-1,4-benzoxazin-4-yl)phenyl]-4-methoxybutanoic acid (PubChem CID 122587503) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-[3-amino-4-(2,3-dihydro-1,4-benzoxazin-4-yl)phenyl]-4-methoxybutanoic acid.
| Compound Name | 3-[3-amino-4-(2,3-dihydro-1,4-benzoxazin-4-yl)phenyl]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 122587503 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-[3-amino-4-(2,3-dihydro-1,4-benzoxazin-4-yl)phenyl]-4-methoxybutanoic acid |
| SMILES | COCC(CC(=O)O)c1ccc(N2CCOc3ccccc32)c(N)c1 |
| InChI | InChI=1S/C19H22N2O4/c1-24-12-14(11-19(22)23)13-6-7-16(15(20)10-13)21-8-9-25-18-5-3-2-4-17(18)21/h2-7,10,14H,8-9,11-12,20H2,1H3,(H,22,23) |
| InChIKey | IXJVLIHDGGSIAN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|