C17H20N2O3S — CID 20947629
5-(2,3-dihydro-1,4-benzoxazin-4-yl)-N-(3-methoxypropyl)thiophene-2-carboxamide (PubChem CID 20947629) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzoxazin-4-yl)-N-(3-methoxypropyl)thiophene-2-carboxamide.
| Compound Name | 5-(2,3-dihydro-1,4-benzoxazin-4-yl)-N-(3-methoxypropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 20947629 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzoxazin-4-yl)-N-(3-methoxypropyl)thiophene-2-carboxamide |
| SMILES | COCCCNC(=O)c1ccc(N2CCOc3ccccc32)s1 |
| InChI | InChI=1S/C17H20N2O3S/c1-21-11-4-9-18-17(20)15-7-8-16(23-15)19-10-12-22-14-6-3-2-5-13(14)19/h2-3,5-8H,4,9-12H2,1H3,(H,18,20) |
| InChIKey | LZJUDGVTDBWABM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|