C25H29ClN2O2S2 — CID 46261141
N-[2-(1-adamantylsulfanyl)ethyl]-5-(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)thiophene-2-carboxamide (PubChem CID 46261141) has the molecular formula C25H29ClN2O2S2 and a molecular weight of 489.11 g/mol. Its IUPAC name is N-[2-(1-adamantylsulfanyl)ethyl]-5-(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)thiophene-2-carboxamide.
| Compound Name | N-[2-(1-adamantylsulfanyl)ethyl]-5-(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46261141 |
| Molecular Formula | C25H29ClN2O2S2 |
| Molecular Weight | 489.11 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | N-[2-(1-adamantylsulfanyl)ethyl]-5-(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)thiophene-2-carboxamide |
| SMILES | O=C(NCCSC12CC3CC(CC(C3)C1)C2)c1ccc(N2CCOc3ccc(Cl)cc32)s1 |
| InChI | InChI=1S/C25H29ClN2O2S2/c26-19-1-2-21-20(12-19)28(6-7-30-21)23-4-3-22(32-23)24(29)27-5-8-31-25-13-16-9-17(14-25)11-18(10-16)15-25/h1-4,12,16-18H,5-11,13-15H2,(H,27,29) |
| InChIKey | SVWDUDAWXBYQOR-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.11 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|