C18H18ClNO3S — CID 39549294
N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 39549294) has the molecular formula C18H18ClNO3S and a molecular weight of 363.87 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 39549294 |
| Molecular Formula | C18H18ClNO3S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | O=C(NCCSCc1ccc(Cl)cc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H18ClNO3S/c19-15-4-1-13(2-5-15)12-24-10-7-20-18(21)14-3-6-16-17(11-14)23-9-8-22-16/h1-6,11H,7-10,12H2,(H,20,21) |
| InChIKey | FWVWQDLCCYUETK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|