C16H14BrCl2NOS — CID 2286732
4-bromo-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]benzamide (PubChem CID 2286732) has the molecular formula C16H14BrCl2NOS and a molecular weight of 419.17 g/mol. Its IUPAC name is 4-bromo-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 2286732 |
| Molecular Formula | C16H14BrCl2NOS |
| Molecular Weight | 419.17 g/mol |
| Exact Mass | 416.94 |
| IUPAC Name | 4-bromo-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]benzamide |
| SMILES | O=C(NCCSCc1ccc(Cl)c(Cl)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H14BrCl2NOS/c17-13-4-2-12(3-5-13)16(21)20-7-8-22-10-11-1-6-14(18)15(19)9-11/h1-6,9H,7-8,10H2,(H,20,21) |
| InChIKey | FKQUBSJIHGLMOF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.17 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|