C27H29Cl2N3O3S2 — CID 43922683
4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]benzamide (PubChem CID 43922683) has the molecular formula C27H29Cl2N3O3S2 and a molecular weight of 578.59 g/mol. Its IUPAC name is 4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]benzamide.
| Compound Name | 4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 43922683 |
| Molecular Formula | C27H29Cl2N3O3S2 |
| Molecular Weight | 578.59 g/mol |
| Exact Mass | 577.10 |
| IUPAC Name | 4-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]benzamide |
| SMILES | O=C(NCCSCc1ccc(Cl)c(Cl)c1)c1ccc(CN2CCN(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H29Cl2N3O3S2/c28-25-11-8-22(18-26(25)29)20-36-17-12-30-27(33)23-9-6-21(7-10-23)19-31-13-15-32(16-14-31)37(34,35)24-4-2-1-3-5-24/h1-11,18H,12-17,19-20H2,(H,30,33) |
| InChIKey | YWBJGQJKXCJYGD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|