C27H30ClN3O3S2 — CID 43920850
3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]benzamide (PubChem CID 43920850) has the molecular formula C27H30ClN3O3S2 and a molecular weight of 544.14 g/mol. Its IUPAC name is 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]benzamide.
| Compound Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 43920850 |
| Molecular Formula | C27H30ClN3O3S2 |
| Molecular Weight | 544.14 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]benzamide |
| SMILES | O=C(NCCSCc1ccccc1Cl)c1cccc(CN2CCN(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H30ClN3O3S2/c28-26-12-5-4-8-24(26)21-35-18-13-29-27(32)23-9-6-7-22(19-23)20-30-14-16-31(17-15-30)36(33,34)25-10-2-1-3-11-25/h1-12,19H,13-18,20-21H2,(H,29,32) |
| InChIKey | PCTPOYBUZSPHNP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.14 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|