C21H25ClN2O2S — CID 92677932
N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-(morpholin-4-ylmethyl)benzamide (PubChem CID 92677932) has the molecular formula C21H25ClN2O2S and a molecular weight of 404.96 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-(morpholin-4-ylmethyl)benzamide.
| Compound Name | N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-(morpholin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 92677932 |
| Molecular Formula | C21H25ClN2O2S |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-(morpholin-4-ylmethyl)benzamide |
| SMILES | O=C(NCCSCc1ccccc1Cl)c1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C21H25ClN2O2S/c22-20-7-2-1-5-19(20)16-27-13-8-23-21(25)18-6-3-4-17(14-18)15-24-9-11-26-12-10-24/h1-7,14H,8-13,15-16H2,(H,23,25) |
| InChIKey | QLXJEHGPLMHMNX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|