C21H25ClN2O2S — CID 31446247
2-[(2-chlorophenyl)methylsulfanyl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]acetamide (PubChem CID 31446247) has the molecular formula C21H25ClN2O2S and a molecular weight of 404.96 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 31446247 |
| Molecular Formula | C21H25ClN2O2S |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]acetamide |
| SMILES | O=C(CSCc1ccccc1Cl)NCc1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C21H25ClN2O2S/c22-20-4-2-1-3-19(20)15-27-16-21(25)23-13-17-5-7-18(8-6-17)14-24-9-11-26-12-10-24/h1-8H,9-16H2,(H,23,25) |
| InChIKey | GKBIXANEQDZXJR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |