C20H25N3O2S — CID 47029720
N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-2-(pyridin-3-ylmethylsulfanyl)acetamide (PubChem CID 47029720) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-2-(pyridin-3-ylmethylsulfanyl)acetamide.
| Compound Name | N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-2-(pyridin-3-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 47029720 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-2-(pyridin-3-ylmethylsulfanyl)acetamide |
| SMILES | O=C(CSCc1cccnc1)NCc1ccccc1CN1CCOCC1 |
| InChI | InChI=1S/C20H25N3O2S/c24-20(16-26-15-17-4-3-7-21-12-17)22-13-18-5-1-2-6-19(18)14-23-8-10-25-11-9-23/h1-7,12H,8-11,13-16H2,(H,22,24) |
| InChIKey | MCGRXAMFDYLFOM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |