C19H21NO3S — CID 32964700
N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 32964700) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 32964700 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | Cc1ccc(CSCCNC(=O)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C19H21NO3S/c1-14-2-4-15(5-3-14)13-24-11-8-20-19(21)16-6-7-17-18(12-16)23-10-9-22-17/h2-7,12H,8-11,13H2,1H3,(H,20,21) |
| InChIKey | HFGGKYKDNPSRMF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|