C17H26N2O4 — CID 122586032
3-[3-amino-4-(3-ethylmorpholin-4-yl)phenyl]-4-methoxybutanoic acid (PubChem CID 122586032) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-[3-amino-4-(3-ethylmorpholin-4-yl)phenyl]-4-methoxybutanoic acid.
| Compound Name | 3-[3-amino-4-(3-ethylmorpholin-4-yl)phenyl]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 122586032 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 3-[3-amino-4-(3-ethylmorpholin-4-yl)phenyl]-4-methoxybutanoic acid |
| SMILES | CCC1COCCN1c1ccc(C(COC)CC(=O)O)cc1N |
| InChI | InChI=1S/C17H26N2O4/c1-3-14-11-23-7-6-19(14)16-5-4-12(8-15(16)18)13(10-22-2)9-17(20)21/h4-5,8,13-14H,3,6-7,9-11,18H2,1-2H3,(H,20,21) |
| InChIKey | YWCCKYPKZULNKJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|