C12H14O4S — CID 115479410
3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfinyl)butan-2-one (PubChem CID 115479410) has the molecular formula C12H14O4S and a molecular weight of 254.31 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfinyl)butan-2-one.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfinyl)butan-2-one |
|---|---|
| PubChem CID | 115479410 |
| Molecular Formula | C12H14O4S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfinyl)butan-2-one |
| SMILES | CC(=O)C(C)S(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H14O4S/c1-8(13)9(2)17(14)10-3-4-11-12(7-10)16-6-5-15-11/h3-4,7,9H,5-6H2,1-2H3 |
| InChIKey | RYVOIVWZOAJCFB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |