C9H10O3S — CID 56986109
3,4-dihydro-2H-chromene-6-sulfinic acid (PubChem CID 56986109) has the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene-6-sulfinic acid.
| Compound Name | 3,4-dihydro-2H-chromene-6-sulfinic acid |
|---|---|
| PubChem CID | 56986109 |
| Molecular Formula | C9H10O3S |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 3,4-dihydro-2H-chromene-6-sulfinic acid |
| SMILES | O=S(O)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C9H10O3S/c10-13(11)8-3-4-9-7(6-8)2-1-5-12-9/h3-4,6H,1-2,5H2,(H,10,11) |
| InChIKey | LPLCSWUKCVWFRG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|