C10H12O2 — CID 142487263
3,4-dihydro-2H-chromene;formaldehyde (PubChem CID 142487263) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene;formaldehyde.
| Compound Name | 3,4-dihydro-2H-chromene;formaldehyde |
|---|---|
| PubChem CID | 142487263 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 3,4-dihydro-2H-chromene;formaldehyde |
| SMILES | C=O.c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C9H10O.CH2O/c1-2-6-9-8(4-1)5-3-7-10-9;1-2/h1-2,4,6H,3,5,7H2;1H2 |
| InChIKey | FPWSHRBCZZOPLU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |