C12H19NO — CID 174740760
3,4-dihydro-2H-chromene;N,N-dimethylmethanamine (PubChem CID 174740760) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene;N,N-dimethylmethanamine.
| Compound Name | 3,4-dihydro-2H-chromene;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 174740760 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3,4-dihydro-2H-chromene;N,N-dimethylmethanamine |
| SMILES | CN(C)C.c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C9H10O.C3H9N/c1-2-6-9-8(4-1)5-3-7-10-9;1-4(2)3/h1-2,4,6H,3,5,7H2;1-3H3 |
| InChIKey | OZAIUIZMKWJHAX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |