C10H14O — CID 54441538
2,3-dihydro-1-benzofuran;ethane (PubChem CID 54441538) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran;ethane.
| Compound Name | 2,3-dihydro-1-benzofuran;ethane |
|---|---|
| PubChem CID | 54441538 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2,3-dihydro-1-benzofuran;ethane |
| SMILES | CC.c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C8H8O.C2H6/c1-2-4-8-7(3-1)5-6-9-8;1-2/h1-4H,5-6H2;1-2H3 |
| InChIKey | WOLFIGQGLCMPCO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |