C15H28O — CID 91076984
3,4-dihydro-2H-chromene;ethane (PubChem CID 91076984) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene;ethane.
| Compound Name | 3,4-dihydro-2H-chromene;ethane |
|---|---|
| PubChem CID | 91076984 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 3,4-dihydro-2H-chromene;ethane |
| SMILES | CC.CC.CC.c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C9H10O.3C2H6/c1-2-6-9-8(4-1)5-3-7-10-9;3*1-2/h1-2,4,6H,3,5,7H2;3*1-2H3 |
| InChIKey | RQPUAXUTQRRDRU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |