C9H11FeLaO+ — CID 175145681
3,4-dihydro-2H-chromene;hydron;iron;lanthanum (PubChem CID 175145681) has the molecular formula C9H11FeLaO+ and a molecular weight of 329.94 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene;hydron;iron;lanthanum.
| Compound Name | 3,4-dihydro-2H-chromene;hydron;iron;lanthanum |
|---|---|
| PubChem CID | 175145681 |
| Molecular Formula | C9H11FeLaO+ |
| Molecular Weight | 329.94 g/mol |
| Exact Mass | 329.92 |
| IUPAC Name | 3,4-dihydro-2H-chromene;hydron;iron;lanthanum |
| SMILES | [Fe].[H+].[La].c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C9H10O.Fe.La/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-2,4,6H,3,5,7H2;;/p+1 |
| InChIKey | PPRYROQLQXKOCC-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.94 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|