About 3,4-dihydro-2H-chromene;1H-indene
3,4-dihydro-2H-chromene;1H-indene (PubChem CID 66618736) has the molecular formula C18H18O
and a molecular weight of 250.34 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene;1H-indene.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-chromene;1H-indene |
| PubChem CID | 66618736 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3,4-dihydro-2H-chromene;1H-indene |
| SMILES | C1=Cc2ccccc2C1.c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C9H10O.C9H8/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-5-9-7-3-6-8(9)4-1/h1-2,4,6H,3,5,7H2;1-6H,7H2 |
| InChIKey | LFIVUPGZYYBPKC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dihydro-2H-chromene;1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-chromene;1H-indene?
The IUPAC name of 3,4-dihydro-2H-chromene;1H-indene (CID 66618736) is 3,4-dihydro-2H-chromene;1H-indene.
What is the SMILES notation for 3,4-dihydro-2H-chromene;1H-indene?
The canonical SMILES for 3,4-dihydro-2H-chromene;1H-indene is C1=Cc2ccccc2C1.c1ccc2c(c1)CCCO2.
What is the InChIKey of 3,4-dihydro-2H-chromene;1H-indene?
The InChIKey is LFIVUPGZYYBPKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C9H8/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-5-9-7-3-6-8(9)4-1/h1-2,4,6H,3,5,7H2;1-6H,7H2.
What are the key properties of 3,4-dihydro-2H-chromene;1H-indene?
3,4-dihydro-2H-chromene;1H-indene has a molecular weight of 250.34 g/mol, XLogP of 4.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-chromene;1H-indene is sourced from PubChem (CID 66618736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).