About 3,4-dihydro-2H-chromene;naphthalene
3,4-dihydro-2H-chromene;naphthalene (PubChem CID 144745299) has the molecular formula C19H18O
and a molecular weight of 262.35 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene;naphthalene.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-chromene;naphthalene |
| PubChem CID | 144745299 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3,4-dihydro-2H-chromene;naphthalene |
| SMILES | c1ccc2c(c1)CCCO2.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C9H10O/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-6-9-8(4-1)5-3-7-10-9/h1-8H;1-2,4,6H,3,5,7H2 |
| InChIKey | TYMCXLGQAMNXDE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dihydro-2H-chromene;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-chromene;naphthalene?
The IUPAC name of 3,4-dihydro-2H-chromene;naphthalene (CID 144745299) is 3,4-dihydro-2H-chromene;naphthalene.
What is the SMILES notation for 3,4-dihydro-2H-chromene;naphthalene?
The canonical SMILES for 3,4-dihydro-2H-chromene;naphthalene is c1ccc2c(c1)CCCO2.c1ccc2ccccc2c1.
What is the InChIKey of 3,4-dihydro-2H-chromene;naphthalene?
The InChIKey is TYMCXLGQAMNXDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C9H10O/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-6-9-8(4-1)5-3-7-10-9/h1-8H;1-2,4,6H,3,5,7H2.
What are the key properties of 3,4-dihydro-2H-chromene;naphthalene?
3,4-dihydro-2H-chromene;naphthalene has a molecular weight of 262.35 g/mol, XLogP of 4.85, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-chromene;naphthalene is sourced from PubChem (CID 144745299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).