C19H18O — CID 144745299
3,4-dihydro-2H-chromene;naphthalene (PubChem CID 144745299) has the molecular formula C19H18O and a molecular weight of 262.35 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene;naphthalene.
| Compound Name | 3,4-dihydro-2H-chromene;naphthalene |
|---|---|
| PubChem CID | 144745299 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3,4-dihydro-2H-chromene;naphthalene |
| SMILES | c1ccc2c(c1)CCCO2.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C9H10O/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-6-9-8(4-1)5-3-7-10-9/h1-8H;1-2,4,6H,3,5,7H2 |
| InChIKey | TYMCXLGQAMNXDE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |